C15H12F3N5O3 — CID 168909376
N-(1-cyanopyrrolidin-3-yl)-5-[3-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole-2-carboxamide (PubChem CID 168909376) has the molecular formula C15H12F3N5O3 and a molecular weight of 367.29 g/mol. Its IUPAC name is N-(1-cyanopyrrolidin-3-yl)-5-[3-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | N-(1-cyanopyrrolidin-3-yl)-5-[3-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 168909376 |
| Molecular Formula | C15H12F3N5O3 |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-(1-cyanopyrrolidin-3-yl)-5-[3-(trifluoromethoxy)phenyl]-1,3,4-oxadiazole-2-carboxamide |
| SMILES | N#CN1CCC(NC(=O)c2nnc(-c3cccc(OC(F)(F)F)c3)o2)C1 |
| InChI | InChI=1S/C15H12F3N5O3/c16-15(17,18)26-11-3-1-2-9(6-11)13-21-22-14(25-13)12(24)20-10-4-5-23(7-10)8-19/h1-3,6,10H,4-5,7H2,(H,20,24) |
| InChIKey | WODMLHINSXWULW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|