About 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile;ethane
6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile;ethane (PubChem CID 168909423) has the molecular formula C14H22N4
and a molecular weight of 246.36 g/mol. Its IUPAC name is 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile;ethane.
Molecular Properties
| Compound Name | 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile;ethane |
| PubChem CID | 168909423 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile;ethane |
| SMILES | CC.C[C@H]1CN(C)CCN1c1cccc(C#N)n1 |
| InChI | InChI=1S/C12H16N4.C2H6/c1-10-9-15(2)6-7-16(10)12-5-3-4-11(8-13)14-12;1-2/h3-5,10H,6-7,9H2,1-2H3;1-2H3/t10-;/m0./s1 |
| InChIKey | VIOWJLPWVMBARK-PPHPATTJSA-N |
| XLogP | 2.12 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile;ethane?
The IUPAC name of 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile;ethane (CID 168909423) is 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile;ethane.
What is the SMILES notation for 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile;ethane?
The canonical SMILES for 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile;ethane is CC.C[C@H]1CN(C)CCN1c1cccc(C#N)n1.
What is the InChIKey of 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile;ethane?
The InChIKey is VIOWJLPWVMBARK-PPHPATTJSA-N. The full InChI is InChI=1S/C12H16N4.C2H6/c1-10-9-15(2)6-7-16(10)12-5-3-4-11(8-13)14-12;1-2/h3-5,10H,6-7,9H2,1-2H3;1-2H3/t10-;/m0./s1.
What are the key properties of 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile;ethane?
6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile;ethane has a molecular weight of 246.36 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile;ethane is sourced from PubChem (CID 168909423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).