C24H35ClN4O3 — CID 168909598
(4Z,6R)-4-[amino-[4-chloro-6-[(2S,3S)-3-methyl-6-(methylamino)hexan-2-yl]oxypyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione (PubChem CID 168909598) has the molecular formula C24H35ClN4O3 and a molecular weight of 463.02 g/mol. Its IUPAC name is (4Z,6R)-4-[amino-[4-chloro-6-[(2S,3S)-3-methyl-6-(methylamino)hexan-2-yl]oxypyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione.
| Compound Name | (4Z,6R)-4-[amino-[4-chloro-6-[(2S,3S)-3-methyl-6-(methylamino)hexan-2-yl]oxypyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
|---|---|
| PubChem CID | 168909598 |
| Molecular Formula | C24H35ClN4O3 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | (4Z,6R)-4-[amino-[4-chloro-6-[(2S,3S)-3-methyl-6-(methylamino)hexan-2-yl]oxypyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
| SMILES | CNCCC[C@H](C)[C@H](C)Oc1cc(Cl)nc(/C(N)=C2\CCC[C@@]3(CCCCC3=O)C2=O)n1 |
| InChI | InChI=1S/C24H35ClN4O3/c1-15(8-7-13-27-3)16(2)32-20-14-19(25)28-23(29-20)21(26)17-9-6-12-24(22(17)31)11-5-4-10-18(24)30/h14-16,27H,4-13,26H2,1-3H3/b21-17-/t15-,16-,24+/m0/s1 |
| InChIKey | RXTRWXRLPGZJES-NHWHSPSKSA-N |
| XLogP | 4.09 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|