About molecular hydrogen;3-propan-2-ylpyrrolidine;hydrofluoride
molecular hydrogen;3-propan-2-ylpyrrolidine;hydrofluoride (PubChem CID 168909701) has the molecular formula C7H18FN
and a molecular weight of 135.23 g/mol. Its IUPAC name is molecular hydrogen;3-propan-2-ylpyrrolidine;hydrofluoride.
Molecular Properties
| Compound Name | molecular hydrogen;3-propan-2-ylpyrrolidine;hydrofluoride |
| PubChem CID | 168909701 |
| Molecular Formula | C7H18FN |
| Molecular Weight | 135.23 g/mol |
| Exact Mass | 135.14 |
| IUPAC Name | molecular hydrogen;3-propan-2-ylpyrrolidine;hydrofluoride |
| SMILES | CC(C)C1CCNC1.F.[H][H] |
| InChI | InChI=1S/C7H15N.FH.H2/c1-6(2)7-3-4-8-5-7;;/h6-8H,3-5H2,1-2H3;2*1H |
| InChIKey | LEAXDPJESFKLHL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze molecular hydrogen;3-propan-2-ylpyrrolidine;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;3-propan-2-ylpyrrolidine;hydrofluoride?
The IUPAC name of molecular hydrogen;3-propan-2-ylpyrrolidine;hydrofluoride (CID 168909701) is molecular hydrogen;3-propan-2-ylpyrrolidine;hydrofluoride.
What is the SMILES notation for molecular hydrogen;3-propan-2-ylpyrrolidine;hydrofluoride?
The canonical SMILES for molecular hydrogen;3-propan-2-ylpyrrolidine;hydrofluoride is CC(C)C1CCNC1.F.[H][H].
What is the InChIKey of molecular hydrogen;3-propan-2-ylpyrrolidine;hydrofluoride?
The InChIKey is LEAXDPJESFKLHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.FH.H2/c1-6(2)7-3-4-8-5-7;;/h6-8H,3-5H2,1-2H3;2*1H.
What are the key properties of molecular hydrogen;3-propan-2-ylpyrrolidine;hydrofluoride?
molecular hydrogen;3-propan-2-ylpyrrolidine;hydrofluoride has a molecular weight of 135.23 g/mol, XLogP of 1.65, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;3-propan-2-ylpyrrolidine;hydrofluoride is sourced from PubChem (CID 168909701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).