C19H26B2N5O3Se — CID 168909797
CID 168909797 (PubChem CID 168909797) has the molecular formula C19H26B2N5O3Se and a molecular weight of 473.03 g/mol.
| Compound Name | CID 168909797 |
|---|---|
| PubChem CID | 168909797 |
| Molecular Formula | C19H26B2N5O3Se |
| Molecular Weight | 473.03 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | — |
| SMILES | C[C@H](Oc1cc(N2CCB(C#N)C3(CC3)C2)nc(C(=O)O)n1)C1CCCN1C.[B][Se] |
| InChI | InChI=1S/C19H26BN5O3.BSe/c1-13(14-4-3-8-24(14)2)28-16-10-15(22-17(23-16)18(26)27)25-9-7-20(12-21)19(11-25)5-6-19;1-2/h10,13-14H,3-9,11H2,1-2H3,(H,26,27);/t13-,14?;/m0./s1 |
| InChIKey | NLQIASBTQAYTNX-GPFYXIAXSA-N |
| XLogP | 1.19 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.03 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|