About CID 168909797
CID 168909797 (PubChem CID 168909797) has the molecular formula C19H26B2N5O3Se
and a molecular weight of 473.03 g/mol.
Molecular Properties
| Compound Name | CID 168909797 |
| PubChem CID | 168909797 |
| Molecular Formula | C19H26B2N5O3Se |
| Molecular Weight | 473.03 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | — |
| SMILES | C[C@H](Oc1cc(N2CCB(C#N)C3(CC3)C2)nc(C(=O)O)n1)C1CCCN1C.[B][Se] |
| InChI | InChI=1S/C19H26BN5O3.BSe/c1-13(14-4-3-8-24(14)2)28-16-10-15(22-17(23-16)18(26)27)25-9-7-20(12-21)19(11-25)5-6-19;1-2/h10,13-14H,3-9,11H2,1-2H3,(H,26,27);/t13-,14?;/m0./s1 |
| InChIKey | NLQIASBTQAYTNX-GPFYXIAXSA-N |
| XLogP | 1.19 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 473.03 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 168909797 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 168909797?
The IUPAC name of CID 168909797 (CID 168909797) is not available.
What is the SMILES notation for CID 168909797?
The canonical SMILES for CID 168909797 is C[C@H](Oc1cc(N2CCB(C#N)C3(CC3)C2)nc(C(=O)O)n1)C1CCCN1C.[B][Se].
What is the InChIKey of CID 168909797?
The InChIKey is NLQIASBTQAYTNX-GPFYXIAXSA-N. The full InChI is InChI=1S/C19H26BN5O3.BSe/c1-13(14-4-3-8-24(14)2)28-16-10-15(22-17(23-16)18(26)27)25-9-7-20(12-21)19(11-25)5-6-19;1-2/h10,13-14H,3-9,11H2,1-2H3,(H,26,27);/t13-,14?;/m0./s1.
What are the key properties of CID 168909797?
CID 168909797 has a molecular weight of 473.03 g/mol, XLogP of 1.19, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 168909797 is sourced from PubChem (CID 168909797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).