About 5-azabicyclo[2.1.1]hexane;1,2,3,4-tetrahydropyridine
5-azabicyclo[2.1.1]hexane;1,2,3,4-tetrahydropyridine (PubChem CID 168910052) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 5-azabicyclo[2.1.1]hexane;1,2,3,4-tetrahydropyridine.
Analyze 5-azabicyclo[2.1.1]hexane;1,2,3,4-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azabicyclo[2.1.1]hexane;1,2,3,4-tetrahydropyridine?
The IUPAC name of 5-azabicyclo[2.1.1]hexane;1,2,3,4-tetrahydropyridine (CID 168910052) is 5-azabicyclo[2.1.1]hexane;1,2,3,4-tetrahydropyridine.
What is the SMILES notation for 5-azabicyclo[2.1.1]hexane;1,2,3,4-tetrahydropyridine?
The canonical SMILES for 5-azabicyclo[2.1.1]hexane;1,2,3,4-tetrahydropyridine is C1=CNCCC1.C1CC2CC1N2.
What is the InChIKey of 5-azabicyclo[2.1.1]hexane;1,2,3,4-tetrahydropyridine?
The InChIKey is NRVOJMIQIYIYBY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H9N/c1-2-5-3-4(1)6-5;1-2-4-6-5-3-1/h4-6H,1-3H2;2,4,6H,1,3,5H2.
What are the key properties of 5-azabicyclo[2.1.1]hexane;1,2,3,4-tetrahydropyridine?
5-azabicyclo[2.1.1]hexane;1,2,3,4-tetrahydropyridine has a molecular weight of 166.27 g/mol, XLogP of 1.39, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azabicyclo[2.1.1]hexane;1,2,3,4-tetrahydropyridine is sourced from PubChem (CID 168910052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).