About 3-[2-(4-chlorobutyl)-1,3-dioxolan-2-yl]thian-4-one
3-[2-(4-chlorobutyl)-1,3-dioxolan-2-yl]thian-4-one (PubChem CID 168910186) has the molecular formula C12H19ClO3S
and a molecular weight of 278.80 g/mol. Its IUPAC name is 3-[2-(4-chlorobutyl)-1,3-dioxolan-2-yl]thian-4-one.
Molecular Properties
| Compound Name | 3-[2-(4-chlorobutyl)-1,3-dioxolan-2-yl]thian-4-one |
| PubChem CID | 168910186 |
| Molecular Formula | C12H19ClO3S |
| Molecular Weight | 278.80 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-[2-(4-chlorobutyl)-1,3-dioxolan-2-yl]thian-4-one |
| SMILES | O=C1CCSCC1C1(CCCCCl)OCCO1 |
| InChI | InChI=1S/C12H19ClO3S/c13-5-2-1-4-12(15-6-7-16-12)10-9-17-8-3-11(10)14/h10H,1-9H2 |
| InChIKey | IMDQQKDSTVUDNK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.80 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(4-chlorobutyl)-1,3-dioxolan-2-yl]thian-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4-chlorobutyl)-1,3-dioxolan-2-yl]thian-4-one?
The IUPAC name of 3-[2-(4-chlorobutyl)-1,3-dioxolan-2-yl]thian-4-one (CID 168910186) is 3-[2-(4-chlorobutyl)-1,3-dioxolan-2-yl]thian-4-one.
What is the SMILES notation for 3-[2-(4-chlorobutyl)-1,3-dioxolan-2-yl]thian-4-one?
The canonical SMILES for 3-[2-(4-chlorobutyl)-1,3-dioxolan-2-yl]thian-4-one is O=C1CCSCC1C1(CCCCCl)OCCO1.
What is the InChIKey of 3-[2-(4-chlorobutyl)-1,3-dioxolan-2-yl]thian-4-one?
The InChIKey is IMDQQKDSTVUDNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19ClO3S/c13-5-2-1-4-12(15-6-7-16-12)10-9-17-8-3-11(10)14/h10H,1-9H2.
What are the key properties of 3-[2-(4-chlorobutyl)-1,3-dioxolan-2-yl]thian-4-one?
3-[2-(4-chlorobutyl)-1,3-dioxolan-2-yl]thian-4-one has a molecular weight of 278.80 g/mol, XLogP of 2.46, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4-chlorobutyl)-1,3-dioxolan-2-yl]thian-4-one is sourced from PubChem (CID 168910186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).