About 2-methoxy-2-methylpropane;methyl 6-[(2S)-2-methyl-1,4-diazepan-1-yl]pyridine-2-carboxylate;hydrate
2-methoxy-2-methylpropane;methyl 6-[(2S)-2-methyl-1,4-diazepan-1-yl]pyridine-2-carboxylate;hydrate (PubChem CID 168910211) has the molecular formula C18H33N3O4
and a molecular weight of 355.48 g/mol. Its IUPAC name is 2-methoxy-2-methylpropane;methyl 6-[(2S)-2-methyl-1,4-diazepan-1-yl]pyridine-2-carboxylate;hydrate.
Molecular Properties
| Compound Name | 2-methoxy-2-methylpropane;methyl 6-[(2S)-2-methyl-1,4-diazepan-1-yl]pyridine-2-carboxylate;hydrate |
| PubChem CID | 168910211 |
| Molecular Formula | C18H33N3O4 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | 2-methoxy-2-methylpropane;methyl 6-[(2S)-2-methyl-1,4-diazepan-1-yl]pyridine-2-carboxylate;hydrate |
| SMILES | COC(=O)c1cccc(N2CCCNC[C@@H]2C)n1.COC(C)(C)C.O |
| InChI | InChI=1S/C13H19N3O2.C5H12O.H2O/c1-10-9-14-7-4-8-16(10)12-6-3-5-11(15-12)13(17)18-2;1-5(2,3)6-4;/h3,5-6,10,14H,4,7-9H2,1-2H3;1-4H3;1H2/t10-;;/m0../s1 |
| InChIKey | ZWOGRBNEYQCGJH-XRIOVQLTSA-N |
| XLogP | 1.66 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methoxy-2-methylpropane;methyl 6-[(2S)-2-methyl-1,4-diazepan-1-yl]pyridine-2-carboxylate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2-methylpropane;methyl 6-[(2S)-2-methyl-1,4-diazepan-1-yl]pyridine-2-carboxylate;hydrate?
The IUPAC name of 2-methoxy-2-methylpropane;methyl 6-[(2S)-2-methyl-1,4-diazepan-1-yl]pyridine-2-carboxylate;hydrate (CID 168910211) is 2-methoxy-2-methylpropane;methyl 6-[(2S)-2-methyl-1,4-diazepan-1-yl]pyridine-2-carboxylate;hydrate.
What is the SMILES notation for 2-methoxy-2-methylpropane;methyl 6-[(2S)-2-methyl-1,4-diazepan-1-yl]pyridine-2-carboxylate;hydrate?
The canonical SMILES for 2-methoxy-2-methylpropane;methyl 6-[(2S)-2-methyl-1,4-diazepan-1-yl]pyridine-2-carboxylate;hydrate is COC(=O)c1cccc(N2CCCNC[C@@H]2C)n1.COC(C)(C)C.O.
What is the InChIKey of 2-methoxy-2-methylpropane;methyl 6-[(2S)-2-methyl-1,4-diazepan-1-yl]pyridine-2-carboxylate;hydrate?
The InChIKey is ZWOGRBNEYQCGJH-XRIOVQLTSA-N. The full InChI is InChI=1S/C13H19N3O2.C5H12O.H2O/c1-10-9-14-7-4-8-16(10)12-6-3-5-11(15-12)13(17)18-2;1-5(2,3)6-4;/h3,5-6,10,14H,4,7-9H2,1-2H3;1-4H3;1H2/t10-;;/m0../s1.
What are the key properties of 2-methoxy-2-methylpropane;methyl 6-[(2S)-2-methyl-1,4-diazepan-1-yl]pyridine-2-carboxylate;hydrate?
2-methoxy-2-methylpropane;methyl 6-[(2S)-2-methyl-1,4-diazepan-1-yl]pyridine-2-carboxylate;hydrate has a molecular weight of 355.48 g/mol, XLogP of 1.66, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2-methylpropane;methyl 6-[(2S)-2-methyl-1,4-diazepan-1-yl]pyridine-2-carboxylate;hydrate is sourced from PubChem (CID 168910211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).