C9H17NO — CID 168910228
acetylene;[(2R)-1,2-dimethylpyrrolidin-2-yl]methanol (PubChem CID 168910228) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is acetylene;[(2R)-1,2-dimethylpyrrolidin-2-yl]methanol.
| Compound Name | acetylene;[(2R)-1,2-dimethylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 168910228 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | acetylene;[(2R)-1,2-dimethylpyrrolidin-2-yl]methanol |
| SMILES | C#C.CN1CCC[C@]1(C)CO |
| InChI | InChI=1S/C7H15NO.C2H2/c1-7(6-9)4-3-5-8(7)2;1-2/h9H,3-6H2,1-2H3;1-2H/t7-;/m1./s1 |
| InChIKey | UJDLSQHESDLOJO-OGFXRTJISA-N |
| XLogP | 0.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|