About (2S)-2,3-dimethyl-1-propan-2-yl-1,4-diazepane
(2S)-2,3-dimethyl-1-propan-2-yl-1,4-diazepane (PubChem CID 168910236) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is (2S)-2,3-dimethyl-1-propan-2-yl-1,4-diazepane.
Molecular Properties
| Compound Name | (2S)-2,3-dimethyl-1-propan-2-yl-1,4-diazepane |
| PubChem CID | 168910236 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | (2S)-2,3-dimethyl-1-propan-2-yl-1,4-diazepane |
| SMILES | CC1NCCCN(C(C)C)[C@H]1C |
| InChI | InChI=1S/C10H22N2/c1-8(2)12-7-5-6-11-9(3)10(12)4/h8-11H,5-7H2,1-4H3/t9?,10-/m0/s1 |
| InChIKey | JDAPZQAOFBIJHN-AXDSSHIGSA-N |
| XLogP | 1.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2,3-dimethyl-1-propan-2-yl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,3-dimethyl-1-propan-2-yl-1,4-diazepane?
The IUPAC name of (2S)-2,3-dimethyl-1-propan-2-yl-1,4-diazepane (CID 168910236) is (2S)-2,3-dimethyl-1-propan-2-yl-1,4-diazepane.
What is the SMILES notation for (2S)-2,3-dimethyl-1-propan-2-yl-1,4-diazepane?
The canonical SMILES for (2S)-2,3-dimethyl-1-propan-2-yl-1,4-diazepane is CC1NCCCN(C(C)C)[C@H]1C.
What is the InChIKey of (2S)-2,3-dimethyl-1-propan-2-yl-1,4-diazepane?
The InChIKey is JDAPZQAOFBIJHN-AXDSSHIGSA-N. The full InChI is InChI=1S/C10H22N2/c1-8(2)12-7-5-6-11-9(3)10(12)4/h8-11H,5-7H2,1-4H3/t9?,10-/m0/s1.
What are the key properties of (2S)-2,3-dimethyl-1-propan-2-yl-1,4-diazepane?
(2S)-2,3-dimethyl-1-propan-2-yl-1,4-diazepane has a molecular weight of 170.30 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,3-dimethyl-1-propan-2-yl-1,4-diazepane is sourced from PubChem (CID 168910236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).