C29H39N7O4 — CID 168910326
(4Z,6R)-4-[amino-[4-[(E)-(3-amino-2-oxo-1H-pyridin-4-yl)methylideneamino]-6-[(2S)-2-methyl-5-(methylamino)pentoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione (PubChem CID 168910326) has the molecular formula C29H39N7O4 and a molecular weight of 549.68 g/mol. Its IUPAC name is (4Z,6R)-4-[amino-[4-[(E)-(3-amino-2-oxo-1H-pyridin-4-yl)methylideneamino]-6-[(2S)-2-methyl-5-(methylamino)pentoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione.
| Compound Name | (4Z,6R)-4-[amino-[4-[(E)-(3-amino-2-oxo-1H-pyridin-4-yl)methylideneamino]-6-[(2S)-2-methyl-5-(methylamino)pentoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
|---|---|
| PubChem CID | 168910326 |
| Molecular Formula | C29H39N7O4 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | (4Z,6R)-4-[amino-[4-[(E)-(3-amino-2-oxo-1H-pyridin-4-yl)methylideneamino]-6-[(2S)-2-methyl-5-(methylamino)pentoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
| SMILES | CNCCC[C@H](C)COc1cc(/N=C/c2cc[nH]c(=O)c2N)nc(/C(N)=C2\CCC[C@@]3(CCCCC3=O)C2=O)n1 |
| InChI | InChI=1S/C29H39N7O4/c1-18(7-6-13-32-2)17-40-23-15-22(34-16-19-10-14-33-28(39)24(19)30)35-27(36-23)25(31)20-8-5-12-29(26(20)38)11-4-3-9-21(29)37/h10,14-16,18,32H,3-9,11-13,17,30-31H2,1-2H3,(H,33,39)/b25-20-,34-16+/t18-,29+/m0/s1 |
| InChIKey | AUSWZWNRHODNHT-SVZBHIGBSA-N |
| XLogP | 3.06 |
| TPSA | 178.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|