C25H36N7O3+ — CID 168910350
[(2Z)-1-[2-[(Z)-amino-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]methyl]-6-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]pyrimidin-4-yl]-2-(methylhydrazinylidene)ethylidene]azanium (PubChem CID 168910350) has the molecular formula C25H36N7O3+ and a molecular weight of 482.61 g/mol. Its IUPAC name is [(2Z)-1-[2-[(Z)-amino-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]methyl]-6-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]pyrimidin-4-yl]-2-(methylhydrazinylidene)ethylidene]azanium.
| Compound Name | [(2Z)-1-[2-[(Z)-amino-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]methyl]-6-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]pyrimidin-4-yl]-2-(methylhydrazinylidene)ethylidene]azanium |
|---|---|
| PubChem CID | 168910350 |
| Molecular Formula | C25H36N7O3+ |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | [(2Z)-1-[2-[(Z)-amino-[(6R)-5,11-dioxospiro[5.5]undecan-4-ylidene]methyl]-6-[[(2S)-1-methylpyrrolidin-2-yl]methoxy]pyrimidin-4-yl]-2-(methylhydrazinylidene)ethylidene]azanium |
| SMILES | CN/N=C\C(=[NH2+])c1cc(OC[C@@H]2CCCN2C)nc(/C(N)=C2\CCC[C@@]3(CCCCC3=O)C2=O)n1 |
| InChI | InChI=1S/C25H35N7O3/c1-28-29-14-18(26)19-13-21(35-15-16-7-6-12-32(16)2)31-24(30-19)22(27)17-8-5-11-25(23(17)34)10-4-3-9-20(25)33/h13-14,16,26,28H,3-12,15,27H2,1-2H3/p+1/b22-17-,26-18?,29-14-/t16-,25+/m0/s1 |
| InChIKey | SZENTTUNDFKXOH-QYSADLKPSA-O |
| XLogP | 0.26 |
| TPSA | 148.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|