C26H38N6O3 — CID 168910372
(4Z,6R)-4-[amino-[4-(4-methylpiperazin-1-yl)-6-[[(2S)-pyrrolidin-2-yl]methoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione (PubChem CID 168910372) has the molecular formula C26H38N6O3 and a molecular weight of 482.63 g/mol. Its IUPAC name is (4Z,6R)-4-[amino-[4-(4-methylpiperazin-1-yl)-6-[[(2S)-pyrrolidin-2-yl]methoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione.
| Compound Name | (4Z,6R)-4-[amino-[4-(4-methylpiperazin-1-yl)-6-[[(2S)-pyrrolidin-2-yl]methoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
|---|---|
| PubChem CID | 168910372 |
| Molecular Formula | C26H38N6O3 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | (4Z,6R)-4-[amino-[4-(4-methylpiperazin-1-yl)-6-[[(2S)-pyrrolidin-2-yl]methoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
| SMILES | CN1CCN(c2cc(OC[C@@H]3CCCN3)nc(/C(N)=C3\CCC[C@@]4(CCCCC4=O)C3=O)n2)CC1 |
| InChI | InChI=1S/C26H38N6O3/c1-31-12-14-32(15-13-31)21-16-22(35-17-18-6-5-11-28-18)30-25(29-21)23(27)19-7-4-10-26(24(19)34)9-3-2-8-20(26)33/h16,18,28H,2-15,17,27H2,1H3/b23-19-/t18-,26+/m0/s1 |
| InChIKey | VDXMZNUGCCZNCW-JJFLEKSRSA-N |
| XLogP | 1.91 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|