C23H33ClN4O3 — CID 168910522
(4Z,6R)-4-[amino-[4-chloro-6-[(2S)-2-methyl-5-(methylamino)pentoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione (PubChem CID 168910522) has the molecular formula C23H33ClN4O3 and a molecular weight of 449.00 g/mol. Its IUPAC name is (4Z,6R)-4-[amino-[4-chloro-6-[(2S)-2-methyl-5-(methylamino)pentoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione.
| Compound Name | (4Z,6R)-4-[amino-[4-chloro-6-[(2S)-2-methyl-5-(methylamino)pentoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
|---|---|
| PubChem CID | 168910522 |
| Molecular Formula | C23H33ClN4O3 |
| Molecular Weight | 449.00 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | (4Z,6R)-4-[amino-[4-chloro-6-[(2S)-2-methyl-5-(methylamino)pentoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
| SMILES | CNCCC[C@H](C)COc1cc(Cl)nc(/C(N)=C2\CCC[C@@]3(CCCCC3=O)C2=O)n1 |
| InChI | InChI=1S/C23H33ClN4O3/c1-15(7-6-12-26-2)14-31-19-13-18(24)27-22(28-19)20(25)16-8-5-11-23(21(16)30)10-4-3-9-17(23)29/h13,15,26H,3-12,14,25H2,1-2H3/b20-16-/t15-,23+/m0/s1 |
| InChIKey | YOXZNIPNAOEEAH-QXIYZIDZSA-N |
| XLogP | 3.70 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.00 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|