C21H28N2O4S — CID 16891059
1-(4-methoxyphenyl)-N-[3-(4-morpholin-4-ylphenyl)propyl]methanesulfonamide (PubChem CID 16891059) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-N-[3-(4-morpholin-4-ylphenyl)propyl]methanesulfonamide.
| Compound Name | 1-(4-methoxyphenyl)-N-[3-(4-morpholin-4-ylphenyl)propyl]methanesulfonamide |
|---|---|
| PubChem CID | 16891059 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 1-(4-methoxyphenyl)-N-[3-(4-morpholin-4-ylphenyl)propyl]methanesulfonamide |
| SMILES | COc1ccc(CS(=O)(=O)NCCCc2ccc(N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C21H28N2O4S/c1-26-21-10-6-19(7-11-21)17-28(24,25)22-12-2-3-18-4-8-20(9-5-18)23-13-15-27-16-14-23/h4-11,22H,2-3,12-17H2,1H3 |
| InChIKey | ICSHQDKLFFTSPS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|