C22H28ClFN4O3 — CID 168910840
(4Z,6R)-4-[amino-[4-chloro-6-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione (PubChem CID 168910840) has the molecular formula C22H28ClFN4O3 and a molecular weight of 450.94 g/mol. Its IUPAC name is (4Z,6R)-4-[amino-[4-chloro-6-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione.
| Compound Name | (4Z,6R)-4-[amino-[4-chloro-6-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
|---|---|
| PubChem CID | 168910840 |
| Molecular Formula | C22H28ClFN4O3 |
| Molecular Weight | 450.94 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | (4Z,6R)-4-[amino-[4-chloro-6-[[(2S,4S)-4-fluoro-1-methylpyrrolidin-2-yl]methoxy]pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
| SMILES | CN1C[C@@H](F)C[C@H]1COc1cc(Cl)nc(/C(N)=C2\CCC[C@@]3(CCCCC3=O)C2=O)n1 |
| InChI | InChI=1S/C22H28ClFN4O3/c1-28-11-13(24)9-14(28)12-31-18-10-17(23)26-21(27-18)19(25)15-5-4-8-22(20(15)30)7-3-2-6-16(22)29/h10,13-14H,2-9,11-12,25H2,1H3/b19-15-/t13-,14-,22+/m0/s1 |
| InChIKey | BPLVPHLIZQYHRA-QGPPHILWSA-N |
| XLogP | 3.10 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.94 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|