About 1-[(2,6-difluorophenyl)methyl]-4-methanimidoylpyrazole-3-carboxamide
1-[(2,6-difluorophenyl)methyl]-4-methanimidoylpyrazole-3-carboxamide (PubChem CID 168911226) has the molecular formula C12H10F2N4O
and a molecular weight of 264.24 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]-4-methanimidoylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-[(2,6-difluorophenyl)methyl]-4-methanimidoylpyrazole-3-carboxamide |
| PubChem CID | 168911226 |
| Molecular Formula | C12H10F2N4O |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]-4-methanimidoylpyrazole-3-carboxamide |
| SMILES | [H]/N=C/c1cn(Cc2c(F)cccc2F)nc1C(N)=O |
| InChI | InChI=1S/C12H10F2N4O/c13-9-2-1-3-10(14)8(9)6-18-5-7(4-15)11(17-18)12(16)19/h1-5,15H,6H2,(H2,16,19)/b15-4+ |
| InChIKey | KYVJTURTUCGGLJ-SYZQJQIISA-N |
| XLogP | 1.31 |
| TPSA | 84.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,6-difluorophenyl)methyl]-4-methanimidoylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,6-difluorophenyl)methyl]-4-methanimidoylpyrazole-3-carboxamide?
The IUPAC name of 1-[(2,6-difluorophenyl)methyl]-4-methanimidoylpyrazole-3-carboxamide (CID 168911226) is 1-[(2,6-difluorophenyl)methyl]-4-methanimidoylpyrazole-3-carboxamide.
What is the SMILES notation for 1-[(2,6-difluorophenyl)methyl]-4-methanimidoylpyrazole-3-carboxamide?
The canonical SMILES for 1-[(2,6-difluorophenyl)methyl]-4-methanimidoylpyrazole-3-carboxamide is [H]/N=C/c1cn(Cc2c(F)cccc2F)nc1C(N)=O.
What is the InChIKey of 1-[(2,6-difluorophenyl)methyl]-4-methanimidoylpyrazole-3-carboxamide?
The InChIKey is KYVJTURTUCGGLJ-SYZQJQIISA-N. The full InChI is InChI=1S/C12H10F2N4O/c13-9-2-1-3-10(14)8(9)6-18-5-7(4-15)11(17-18)12(16)19/h1-5,15H,6H2,(H2,16,19)/b15-4+.
What are the key properties of 1-[(2,6-difluorophenyl)methyl]-4-methanimidoylpyrazole-3-carboxamide?
1-[(2,6-difluorophenyl)methyl]-4-methanimidoylpyrazole-3-carboxamide has a molecular weight of 264.24 g/mol, XLogP of 1.31, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,6-difluorophenyl)methyl]-4-methanimidoylpyrazole-3-carboxamide is sourced from PubChem (CID 168911226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).