About N-[(2,6-difluorophenyl)methyl]-2-hydrazinylidene-3-imino-4-oxobutanimidoyl chloride
N-[(2,6-difluorophenyl)methyl]-2-hydrazinylidene-3-imino-4-oxobutanimidoyl chloride (PubChem CID 168911365) has the molecular formula C11H9ClF2N4O
and a molecular weight of 286.67 g/mol. Its IUPAC name is N-[(2,6-difluorophenyl)methyl]-2-hydrazinylidene-3-imino-4-oxobutanimidoyl chloride.
Molecular Properties
| Compound Name | N-[(2,6-difluorophenyl)methyl]-2-hydrazinylidene-3-imino-4-oxobutanimidoyl chloride |
| PubChem CID | 168911365 |
| Molecular Formula | C11H9ClF2N4O |
| Molecular Weight | 286.67 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | N-[(2,6-difluorophenyl)methyl]-2-hydrazinylidene-3-imino-4-oxobutanimidoyl chloride |
| SMILES | [H]/N=C(\C=O)C(=NN)/C(Cl)=N/Cc1c(F)cccc1F |
| InChI | InChI=1S/C11H9ClF2N4O/c12-11(10(18-16)9(15)5-19)17-4-6-7(13)2-1-3-8(6)14/h1-3,5,15H,4,16H2/b15-9+,17-11-,18-10? |
| InChIKey | JSEUGPKHVRRTSX-GJJKZZKPSA-N |
| XLogP | 1.64 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.67 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,6-difluorophenyl)methyl]-2-hydrazinylidene-3-imino-4-oxobutanimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,6-difluorophenyl)methyl]-2-hydrazinylidene-3-imino-4-oxobutanimidoyl chloride?
The IUPAC name of N-[(2,6-difluorophenyl)methyl]-2-hydrazinylidene-3-imino-4-oxobutanimidoyl chloride (CID 168911365) is N-[(2,6-difluorophenyl)methyl]-2-hydrazinylidene-3-imino-4-oxobutanimidoyl chloride.
What is the SMILES notation for N-[(2,6-difluorophenyl)methyl]-2-hydrazinylidene-3-imino-4-oxobutanimidoyl chloride?
The canonical SMILES for N-[(2,6-difluorophenyl)methyl]-2-hydrazinylidene-3-imino-4-oxobutanimidoyl chloride is [H]/N=C(\C=O)C(=NN)/C(Cl)=N/Cc1c(F)cccc1F.
What is the InChIKey of N-[(2,6-difluorophenyl)methyl]-2-hydrazinylidene-3-imino-4-oxobutanimidoyl chloride?
The InChIKey is JSEUGPKHVRRTSX-GJJKZZKPSA-N. The full InChI is InChI=1S/C11H9ClF2N4O/c12-11(10(18-16)9(15)5-19)17-4-6-7(13)2-1-3-8(6)14/h1-3,5,15H,4,16H2/b15-9+,17-11-,18-10?.
What are the key properties of N-[(2,6-difluorophenyl)methyl]-2-hydrazinylidene-3-imino-4-oxobutanimidoyl chloride?
N-[(2,6-difluorophenyl)methyl]-2-hydrazinylidene-3-imino-4-oxobutanimidoyl chloride has a molecular weight of 286.67 g/mol, XLogP of 1.64, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,6-difluorophenyl)methyl]-2-hydrazinylidene-3-imino-4-oxobutanimidoyl chloride is sourced from PubChem (CID 168911365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).