C21H27FN2O3S — CID 16891167
3-fluoro-4-methoxy-N-[3-(4-piperidin-1-ylphenyl)propyl]benzenesulfonamide (PubChem CID 16891167) has the molecular formula C21H27FN2O3S and a molecular weight of 406.52 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-N-[3-(4-piperidin-1-ylphenyl)propyl]benzenesulfonamide.
| Compound Name | 3-fluoro-4-methoxy-N-[3-(4-piperidin-1-ylphenyl)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16891167 |
| Molecular Formula | C21H27FN2O3S |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 3-fluoro-4-methoxy-N-[3-(4-piperidin-1-ylphenyl)propyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCCc2ccc(N3CCCCC3)cc2)cc1F |
| InChI | InChI=1S/C21H27FN2O3S/c1-27-21-12-11-19(16-20(21)22)28(25,26)23-13-5-6-17-7-9-18(10-8-17)24-14-3-2-4-15-24/h7-12,16,23H,2-6,13-15H2,1H3 |
| InChIKey | COTWJKTVTHBWHA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|