About (E)-5,5-dimethyl-2-[[1-methyl-3-(2-methylpropyl)pyrazole-5-carbonyl]amino]hex-3-enoic acid
(E)-5,5-dimethyl-2-[[1-methyl-3-(2-methylpropyl)pyrazole-5-carbonyl]amino]hex-3-enoic acid (PubChem CID 168911993) has the molecular formula C17H27N3O3
and a molecular weight of 321.42 g/mol. Its IUPAC name is (E)-5,5-dimethyl-2-[[1-methyl-3-(2-methylpropyl)pyrazole-5-carbonyl]amino]hex-3-enoic acid.
Molecular Properties
| Compound Name | (E)-5,5-dimethyl-2-[[1-methyl-3-(2-methylpropyl)pyrazole-5-carbonyl]amino]hex-3-enoic acid |
| PubChem CID | 168911993 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (E)-5,5-dimethyl-2-[[1-methyl-3-(2-methylpropyl)pyrazole-5-carbonyl]amino]hex-3-enoic acid |
| SMILES | CC(C)Cc1cc(C(=O)NC(/C=C/C(C)(C)C)C(=O)O)n(C)n1 |
| InChI | InChI=1S/C17H27N3O3/c1-11(2)9-12-10-14(20(6)19-12)15(21)18-13(16(22)23)7-8-17(3,4)5/h7-8,10-11,13H,9H2,1-6H3,(H,18,21)(H,22,23)/b8-7+ |
| InChIKey | FYNXLRYGYGTDOU-BQYQJAHWSA-N |
| XLogP | 2.40 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5,5-dimethyl-2-[[1-methyl-3-(2-methylpropyl)pyrazole-5-carbonyl]amino]hex-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5,5-dimethyl-2-[[1-methyl-3-(2-methylpropyl)pyrazole-5-carbonyl]amino]hex-3-enoic acid?
The IUPAC name of (E)-5,5-dimethyl-2-[[1-methyl-3-(2-methylpropyl)pyrazole-5-carbonyl]amino]hex-3-enoic acid (CID 168911993) is (E)-5,5-dimethyl-2-[[1-methyl-3-(2-methylpropyl)pyrazole-5-carbonyl]amino]hex-3-enoic acid.
What is the SMILES notation for (E)-5,5-dimethyl-2-[[1-methyl-3-(2-methylpropyl)pyrazole-5-carbonyl]amino]hex-3-enoic acid?
The canonical SMILES for (E)-5,5-dimethyl-2-[[1-methyl-3-(2-methylpropyl)pyrazole-5-carbonyl]amino]hex-3-enoic acid is CC(C)Cc1cc(C(=O)NC(/C=C/C(C)(C)C)C(=O)O)n(C)n1.
What is the InChIKey of (E)-5,5-dimethyl-2-[[1-methyl-3-(2-methylpropyl)pyrazole-5-carbonyl]amino]hex-3-enoic acid?
The InChIKey is FYNXLRYGYGTDOU-BQYQJAHWSA-N. The full InChI is InChI=1S/C17H27N3O3/c1-11(2)9-12-10-14(20(6)19-12)15(21)18-13(16(22)23)7-8-17(3,4)5/h7-8,10-11,13H,9H2,1-6H3,(H,18,21)(H,22,23)/b8-7+.
What are the key properties of (E)-5,5-dimethyl-2-[[1-methyl-3-(2-methylpropyl)pyrazole-5-carbonyl]amino]hex-3-enoic acid?
(E)-5,5-dimethyl-2-[[1-methyl-3-(2-methylpropyl)pyrazole-5-carbonyl]amino]hex-3-enoic acid has a molecular weight of 321.42 g/mol, XLogP of 2.40, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5,5-dimethyl-2-[[1-methyl-3-(2-methylpropyl)pyrazole-5-carbonyl]amino]hex-3-enoic acid is sourced from PubChem (CID 168911993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).