C34H31F2N7O2 — CID 168912427
4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[3,2-d]pyrimidine-8-carbonitrile (PubChem CID 168912427) has the molecular formula C34H31F2N7O2 and a molecular weight of 607.67 g/mol. Its IUPAC name is 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[3,2-d]pyrimidine-8-carbonitrile.
| Compound Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[3,2-d]pyrimidine-8-carbonitrile |
|---|---|
| PubChem CID | 168912427 |
| Molecular Formula | C34H31F2N7O2 |
| Molecular Weight | 607.67 g/mol |
| Exact Mass | 607.25 |
| IUPAC Name | 4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)-2-[(2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl)methoxy]pyrido[3,2-d]pyrimidine-8-carbonitrile |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-c3cnc4c(N5CC6CCC(C5)N6)nc(OCC56CCCN5CC(F)C6)nc4c3C#N)c12 |
| InChI | InChI=1S/C34H31F2N7O2/c1-2-24-28(36)7-4-19-10-23(44)11-25(29(19)24)27-14-38-31-30(26(27)13-37)40-33(41-32(31)42-16-21-5-6-22(17-42)39-21)45-18-34-8-3-9-43(34)15-20(35)12-34/h1,4,7,10-11,14,20-22,39,44H,3,5-6,8-9,12,15-18H2 |
| InChIKey | KZJUIFOGBRNQOV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.67 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|