C33H39N5O2 — CID 168912502
(2'S,6'S)-1'-benzyl-1-[(4-methoxyphenyl)methyl]-2',8-dimethyl-6'-(1-methyltriazol-4-yl)spiro[2,4-dihydro-3,1-benzoxazepine-5,4'-piperidine] (PubChem CID 168912502) has the molecular formula C33H39N5O2 and a molecular weight of 537.71 g/mol. Its IUPAC name is (2'S,6'S)-1'-benzyl-1-[(4-methoxyphenyl)methyl]-2',8-dimethyl-6'-(1-methyltriazol-4-yl)spiro[2,4-dihydro-3,1-benzoxazepine-5,4'-piperidine].
| Compound Name | (2'S,6'S)-1'-benzyl-1-[(4-methoxyphenyl)methyl]-2',8-dimethyl-6'-(1-methyltriazol-4-yl)spiro[2,4-dihydro-3,1-benzoxazepine-5,4'-piperidine] |
|---|---|
| PubChem CID | 168912502 |
| Molecular Formula | C33H39N5O2 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | (2'S,6'S)-1'-benzyl-1-[(4-methoxyphenyl)methyl]-2',8-dimethyl-6'-(1-methyltriazol-4-yl)spiro[2,4-dihydro-3,1-benzoxazepine-5,4'-piperidine] |
| SMILES | COc1ccc(CN2COCC3(C[C@H](C)N(Cc4ccccc4)[C@H](c4cn(C)nn4)C3)c3ccc(C)cc32)cc1 |
| InChI | InChI=1S/C33H39N5O2/c1-24-10-15-29-31(16-24)37(19-27-11-13-28(39-4)14-12-27)23-40-22-33(29)17-25(2)38(20-26-8-6-5-7-9-26)32(18-33)30-21-36(3)35-34-30/h5-16,21,25,32H,17-20,22-23H2,1-4H3/t25-,32-,33?/m0/s1 |
| InChIKey | CJCXPRSVKYGBBX-JQXBJYDYSA-N |
| XLogP | 5.79 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |