C18H19ClN4O — CID 168912521
(1S,2'R,6'S)-7-chloro-2'-ethynyl-6'-(1-methyltriazol-4-yl)spiro[3,4-dihydroisochromene-1,4'-piperidine] (PubChem CID 168912521) has the molecular formula C18H19ClN4O and a molecular weight of 342.83 g/mol. Its IUPAC name is (1S,2'R,6'S)-7-chloro-2'-ethynyl-6'-(1-methyltriazol-4-yl)spiro[3,4-dihydroisochromene-1,4'-piperidine].
| Compound Name | (1S,2'R,6'S)-7-chloro-2'-ethynyl-6'-(1-methyltriazol-4-yl)spiro[3,4-dihydroisochromene-1,4'-piperidine] |
|---|---|
| PubChem CID | 168912521 |
| Molecular Formula | C18H19ClN4O |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (1S,2'R,6'S)-7-chloro-2'-ethynyl-6'-(1-methyltriazol-4-yl)spiro[3,4-dihydroisochromene-1,4'-piperidine] |
| SMILES | C#C[C@H]1C[C@@]2(C[C@@H](c3cn(C)nn3)N1)OCCc1ccc(Cl)cc12 |
| InChI | InChI=1S/C18H19ClN4O/c1-3-14-9-18(10-16(20-14)17-11-23(2)22-21-17)15-8-13(19)5-4-12(15)6-7-24-18/h1,4-5,8,11,14,16,20H,6-7,9-10H2,2H3/t14-,16-,18-/m0/s1 |
| InChIKey | BRPRKHDDPCIJOY-ZVZYQTTQSA-N |
| XLogP | 2.36 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|