C19H26ClN3O2S — CID 168912527
(2'S)-2'-[(Z)-1-amino-3-(2-methylsulfanylethylimino)prop-1-en-2-yl]-7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol (PubChem CID 168912527) has the molecular formula C19H26ClN3O2S and a molecular weight of 395.96 g/mol. Its IUPAC name is (2'S)-2'-[(Z)-1-amino-3-(2-methylsulfanylethylimino)prop-1-en-2-yl]-7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol.
| Compound Name | (2'S)-2'-[(Z)-1-amino-3-(2-methylsulfanylethylimino)prop-1-en-2-yl]-7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol |
|---|---|
| PubChem CID | 168912527 |
| Molecular Formula | C19H26ClN3O2S |
| Molecular Weight | 395.96 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | (2'S)-2'-[(Z)-1-amino-3-(2-methylsulfanylethylimino)prop-1-en-2-yl]-7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-ol |
| SMILES | CSCC/N=C/C(=C\N)[C@@H]1CC2(CCN1)OCCc1cc(O)c(Cl)cc12 |
| InChI | InChI=1S/C19H26ClN3O2S/c1-26-7-5-22-12-14(11-21)17-10-19(3-4-23-17)15-9-16(20)18(24)8-13(15)2-6-25-19/h8-9,11-12,17,23-24H,2-7,10,21H2,1H3/b14-11+,22-12+/t17-,19?/m0/s1 |
| InChIKey | JUVSAARWYHUFOL-VMCBNCGMSA-N |
| XLogP | 2.84 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.96 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|