C17H21ClN4O2 — CID 168912615
(1S,2'S,4S,6'S)-6-chloro-2'-methyl-6'-(1-methyltriazol-4-yl)spiro[3,4-dihydroisochromene-1,4'-piperidine]-4-ol (PubChem CID 168912615) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is (1S,2'S,4S,6'S)-6-chloro-2'-methyl-6'-(1-methyltriazol-4-yl)spiro[3,4-dihydroisochromene-1,4'-piperidine]-4-ol.
| Compound Name | (1S,2'S,4S,6'S)-6-chloro-2'-methyl-6'-(1-methyltriazol-4-yl)spiro[3,4-dihydroisochromene-1,4'-piperidine]-4-ol |
|---|---|
| PubChem CID | 168912615 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (1S,2'S,4S,6'S)-6-chloro-2'-methyl-6'-(1-methyltriazol-4-yl)spiro[3,4-dihydroisochromene-1,4'-piperidine]-4-ol |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3cn(C)nn3)N1)OC[C@@H](O)c1cc(Cl)ccc12 |
| InChI | InChI=1S/C17H21ClN4O2/c1-10-6-17(7-14(19-10)15-8-22(2)21-20-15)13-4-3-11(18)5-12(13)16(23)9-24-17/h3-5,8,10,14,16,19,23H,6-7,9H2,1-2H3/t10-,14-,16+,17-/m0/s1 |
| InChIKey | SQNLOSAHPIWQAE-ZQEPISKBSA-N |
| XLogP | 2.24 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |