C19H20ClF3N4O3 — CID 168912623
1-[(1S,2'S,4S,6'S)-6-chloro-4-hydroxy-2'-methyl-6'-(1-methyltriazol-4-yl)spiro[3,4-dihydroisochromene-1,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone (PubChem CID 168912623) has the molecular formula C19H20ClF3N4O3 and a molecular weight of 444.84 g/mol. Its IUPAC name is 1-[(1S,2'S,4S,6'S)-6-chloro-4-hydroxy-2'-methyl-6'-(1-methyltriazol-4-yl)spiro[3,4-dihydroisochromene-1,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(1S,2'S,4S,6'S)-6-chloro-4-hydroxy-2'-methyl-6'-(1-methyltriazol-4-yl)spiro[3,4-dihydroisochromene-1,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 168912623 |
| Molecular Formula | C19H20ClF3N4O3 |
| Molecular Weight | 444.84 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 1-[(1S,2'S,4S,6'S)-6-chloro-4-hydroxy-2'-methyl-6'-(1-methyltriazol-4-yl)spiro[3,4-dihydroisochromene-1,4'-piperidine]-1'-yl]-2,2,2-trifluoroethanone |
| SMILES | C[C@H]1C[C@@]2(C[C@@H](c3cn(C)nn3)N1C(=O)C(F)(F)F)OC[C@@H](O)c1cc(Cl)ccc12 |
| InChI | InChI=1S/C19H20ClF3N4O3/c1-10-6-18(13-4-3-11(20)5-12(13)16(28)9-30-18)7-15(14-8-26(2)25-24-14)27(10)17(29)19(21,22)23/h3-5,8,10,15-16,28H,6-7,9H2,1-2H3/t10-,15-,16+,18-/m0/s1 |
| InChIKey | XNPKMOMHDDRLAM-LUUCLCGZSA-N |
| XLogP | 3.04 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |