C17H26BClN4O — CID 168912662
(Z)-2-[(2'S,6'S)-7-chloro-1-hydroxy-6'-methylspiro[2,3-dihydro-1-benzoborinine-4,4'-piperidine]-2'-yl]-2-hydrazinyl-N-methylethenamine (PubChem CID 168912662) has the molecular formula C17H26BClN4O and a molecular weight of 348.69 g/mol. Its IUPAC name is (Z)-2-[(2'S,6'S)-7-chloro-1-hydroxy-6'-methylspiro[2,3-dihydro-1-benzoborinine-4,4'-piperidine]-2'-yl]-2-hydrazinyl-N-methylethenamine.
| Compound Name | (Z)-2-[(2'S,6'S)-7-chloro-1-hydroxy-6'-methylspiro[2,3-dihydro-1-benzoborinine-4,4'-piperidine]-2'-yl]-2-hydrazinyl-N-methylethenamine |
|---|---|
| PubChem CID | 168912662 |
| Molecular Formula | C17H26BClN4O |
| Molecular Weight | 348.69 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (Z)-2-[(2'S,6'S)-7-chloro-1-hydroxy-6'-methylspiro[2,3-dihydro-1-benzoborinine-4,4'-piperidine]-2'-yl]-2-hydrazinyl-N-methylethenamine |
| SMILES | CN/C=C(\NN)[C@@H]1CC2(CCB(O)c3cc(Cl)ccc32)C[C@H](C)N1 |
| InChI | InChI=1S/C17H26BClN4O/c1-11-8-17(9-15(22-11)16(23-20)10-21-2)5-6-18(24)14-7-12(19)3-4-13(14)17/h3-4,7,10-11,15,21-24H,5-6,8-9,20H2,1-2H3/b16-10-/t11-,15-,17?/m0/s1 |
| InChIKey | WFKFYTKFDQFSHW-IIDLJTTASA-N |
| XLogP | 0.84 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.69 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|