About (7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-yl) trifluoromethanesulfonate
(7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-yl) trifluoromethanesulfonate (PubChem CID 168912673) has the molecular formula C14H15ClF3NO4S
and a molecular weight of 385.79 g/mol. Its IUPAC name is (7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-yl) trifluoromethanesulfonate |
| PubChem CID | 168912673 |
| Molecular Formula | C14H15ClF3NO4S |
| Molecular Weight | 385.79 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | (7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-yl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cc2c(cc1Cl)C1(CCNCC1)OCC2)C(F)(F)F |
| InChI | InChI=1S/C14H15ClF3NO4S/c15-11-8-10-9(1-6-22-13(10)2-4-19-5-3-13)7-12(11)23-24(20,21)14(16,17)18/h7-8,19H,1-6H2 |
| InChIKey | MMHGDEHZICTXGI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.79 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-yl) trifluoromethanesulfonate?
The IUPAC name of (7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-yl) trifluoromethanesulfonate (CID 168912673) is (7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-yl) trifluoromethanesulfonate.
What is the SMILES notation for (7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-yl) trifluoromethanesulfonate?
The canonical SMILES for (7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-yl) trifluoromethanesulfonate is O=S(=O)(Oc1cc2c(cc1Cl)C1(CCNCC1)OCC2)C(F)(F)F.
What is the InChIKey of (7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-yl) trifluoromethanesulfonate?
The InChIKey is MMHGDEHZICTXGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClF3NO4S/c15-11-8-10-9(1-6-22-13(10)2-4-19-5-3-13)7-12(11)23-24(20,21)14(16,17)18/h7-8,19H,1-6H2.
What are the key properties of (7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-yl) trifluoromethanesulfonate?
(7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-yl) trifluoromethanesulfonate has a molecular weight of 385.79 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-chlorospiro[3,4-dihydroisochromene-1,4'-piperidine]-6-yl) trifluoromethanesulfonate is sourced from PubChem (CID 168912673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).