C20H25F3N4 — CID 168912705
(2S,4R,6S)-2,4-dimethyl-6-(1-methyltriazol-4-yl)-1-prop-2-enyl-4-[4-(trifluoromethyl)phenyl]piperidine (PubChem CID 168912705) has the molecular formula C20H25F3N4 and a molecular weight of 378.44 g/mol. Its IUPAC name is (2S,4R,6S)-2,4-dimethyl-6-(1-methyltriazol-4-yl)-1-prop-2-enyl-4-[4-(trifluoromethyl)phenyl]piperidine.
| Compound Name | (2S,4R,6S)-2,4-dimethyl-6-(1-methyltriazol-4-yl)-1-prop-2-enyl-4-[4-(trifluoromethyl)phenyl]piperidine |
|---|---|
| PubChem CID | 168912705 |
| Molecular Formula | C20H25F3N4 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (2S,4R,6S)-2,4-dimethyl-6-(1-methyltriazol-4-yl)-1-prop-2-enyl-4-[4-(trifluoromethyl)phenyl]piperidine |
| SMILES | C=CCN1[C@@H](C)C[C@@](C)(c2ccc(C(F)(F)F)cc2)C[C@H]1c1cn(C)nn1 |
| InChI | InChI=1S/C20H25F3N4/c1-5-10-27-14(2)11-19(3,12-18(27)17-13-26(4)25-24-17)15-6-8-16(9-7-15)20(21,22)23/h5-9,13-14,18H,1,10-12H2,2-4H3/t14-,18-,19+/m0/s1 |
| InChIKey | RUZYVZFZCYZFRH-ZOCIIQOWSA-N |
| XLogP | 4.50 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|