C14H21F3N4 — CID 168913039
butane;(3Z)-4-[2-(trifluoromethyl)-3-pyridinyl]buta-1,3-diene-1,1,4-triamine (PubChem CID 168913039) has the molecular formula C14H21F3N4 and a molecular weight of 302.34 g/mol. Its IUPAC name is butane;(3Z)-4-[2-(trifluoromethyl)-3-pyridinyl]buta-1,3-diene-1,1,4-triamine.
| Compound Name | butane;(3Z)-4-[2-(trifluoromethyl)-3-pyridinyl]buta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 168913039 |
| Molecular Formula | C14H21F3N4 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | butane;(3Z)-4-[2-(trifluoromethyl)-3-pyridinyl]buta-1,3-diene-1,1,4-triamine |
| SMILES | CCCC.NC(N)=C/C=C(\N)c1cccnc1C(F)(F)F |
| InChI | InChI=1S/C10H11F3N4.C4H10/c11-10(12,13)9-6(2-1-5-17-9)7(14)3-4-8(15)16;1-3-4-2/h1-5H,14-16H2;3-4H2,1-2H3/b7-3-; |
| InChIKey | BBMXZCNGCARJAC-WYLUAFJRSA-N |
| XLogP | 2.97 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|