About cyclohexane;5-(trifluoromethyl)-1,3-thiazol-2-amine
cyclohexane;5-(trifluoromethyl)-1,3-thiazol-2-amine (PubChem CID 168914029) has the molecular formula C10H15F3N2S
and a molecular weight of 252.30 g/mol. Its IUPAC name is cyclohexane;5-(trifluoromethyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | cyclohexane;5-(trifluoromethyl)-1,3-thiazol-2-amine |
| PubChem CID | 168914029 |
| Molecular Formula | C10H15F3N2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | cyclohexane;5-(trifluoromethyl)-1,3-thiazol-2-amine |
| SMILES | C1CCCCC1.Nc1ncc(C(F)(F)F)s1 |
| InChI | InChI=1S/C6H12.C4H3F3N2S/c1-2-4-6-5-3-1;5-4(6,7)2-1-9-3(8)10-2/h1-6H2;1H,(H2,8,9) |
| InChIKey | DNBGWHYDRZVSSV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexane;5-(trifluoromethyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;5-(trifluoromethyl)-1,3-thiazol-2-amine?
The IUPAC name of cyclohexane;5-(trifluoromethyl)-1,3-thiazol-2-amine (CID 168914029) is cyclohexane;5-(trifluoromethyl)-1,3-thiazol-2-amine.
What is the SMILES notation for cyclohexane;5-(trifluoromethyl)-1,3-thiazol-2-amine?
The canonical SMILES for cyclohexane;5-(trifluoromethyl)-1,3-thiazol-2-amine is C1CCCCC1.Nc1ncc(C(F)(F)F)s1.
What is the InChIKey of cyclohexane;5-(trifluoromethyl)-1,3-thiazol-2-amine?
The InChIKey is DNBGWHYDRZVSSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12.C4H3F3N2S/c1-2-4-6-5-3-1;5-4(6,7)2-1-9-3(8)10-2/h1-6H2;1H,(H2,8,9).
What are the key properties of cyclohexane;5-(trifluoromethyl)-1,3-thiazol-2-amine?
cyclohexane;5-(trifluoromethyl)-1,3-thiazol-2-amine has a molecular weight of 252.30 g/mol, XLogP of 4.08, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;5-(trifluoromethyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 168914029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).