About 6-bromo-2,3-dihydroisoindol-1-one;cyclohexane
6-bromo-2,3-dihydroisoindol-1-one;cyclohexane (PubChem CID 168914120) has the molecular formula C14H18BrNO
and a molecular weight of 296.21 g/mol. Its IUPAC name is 6-bromo-2,3-dihydroisoindol-1-one;cyclohexane.
Molecular Properties
| Compound Name | 6-bromo-2,3-dihydroisoindol-1-one;cyclohexane |
| PubChem CID | 168914120 |
| Molecular Formula | C14H18BrNO |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 6-bromo-2,3-dihydroisoindol-1-one;cyclohexane |
| SMILES | C1CCCCC1.O=C1NCc2ccc(Br)cc21 |
| InChI | InChI=1S/C8H6BrNO.C6H12/c9-6-2-1-5-4-10-8(11)7(5)3-6;1-2-4-6-5-3-1/h1-3H,4H2,(H,10,11);1-6H2 |
| InChIKey | NHFVHPPRDYUTQO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-2,3-dihydroisoindol-1-one;cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,3-dihydroisoindol-1-one;cyclohexane?
The IUPAC name of 6-bromo-2,3-dihydroisoindol-1-one;cyclohexane (CID 168914120) is 6-bromo-2,3-dihydroisoindol-1-one;cyclohexane.
What is the SMILES notation for 6-bromo-2,3-dihydroisoindol-1-one;cyclohexane?
The canonical SMILES for 6-bromo-2,3-dihydroisoindol-1-one;cyclohexane is C1CCCCC1.O=C1NCc2ccc(Br)cc21.
What is the InChIKey of 6-bromo-2,3-dihydroisoindol-1-one;cyclohexane?
The InChIKey is NHFVHPPRDYUTQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrNO.C6H12/c9-6-2-1-5-4-10-8(11)7(5)3-6;1-2-4-6-5-3-1/h1-3H,4H2,(H,10,11);1-6H2.
What are the key properties of 6-bromo-2,3-dihydroisoindol-1-one;cyclohexane?
6-bromo-2,3-dihydroisoindol-1-one;cyclohexane has a molecular weight of 296.21 g/mol, XLogP of 4.03, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,3-dihydroisoindol-1-one;cyclohexane is sourced from PubChem (CID 168914120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).