C28H31N9O2 — CID 168914194
1-[3-amino-5-[[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]carbamoylamino]phenyl]-3-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]urea (PubChem CID 168914194) has the molecular formula C28H31N9O2 and a molecular weight of 525.62 g/mol. Its IUPAC name is 1-[3-amino-5-[[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]carbamoylamino]phenyl]-3-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]urea.
| Compound Name | 1-[3-amino-5-[[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]carbamoylamino]phenyl]-3-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 168914194 |
| Molecular Formula | C28H31N9O2 |
| Molecular Weight | 525.62 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | 1-[3-amino-5-[[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]carbamoylamino]phenyl]-3-[4-(1,4,5,6-tetrahydropyrimidin-2-yl)phenyl]urea |
| SMILES | Nc1cc(NC(=O)Nc2ccc(C3=NCCCN3)cc2)cc(NC(=O)Nc2ccc(C3=NCCCN3)cc2)c1 |
| InChI | InChI=1S/C28H31N9O2/c29-20-15-23(36-27(38)34-21-7-3-18(4-8-21)25-30-11-1-12-31-25)17-24(16-20)37-28(39)35-22-9-5-19(6-10-22)26-32-13-2-14-33-26/h3-10,15-17H,1-2,11-14,29H2,(H,30,31)(H,32,33)(H2,34,36,38)(H2,35,37,39) |
| InChIKey | SHPALUDHBZHCEJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 157.06 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.62 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|