C27H28F5NO2S — CID 168914643
2-[bis(4-fluorophenyl)methyl]-N-[4-(trifluoromethoxy)phenyl]sulfanyloxan-4-amine;ethane (PubChem CID 168914643) has the molecular formula C27H28F5NO2S and a molecular weight of 525.58 g/mol. Its IUPAC name is 2-[bis(4-fluorophenyl)methyl]-N-[4-(trifluoromethoxy)phenyl]sulfanyloxan-4-amine;ethane.
| Compound Name | 2-[bis(4-fluorophenyl)methyl]-N-[4-(trifluoromethoxy)phenyl]sulfanyloxan-4-amine;ethane |
|---|---|
| PubChem CID | 168914643 |
| Molecular Formula | C27H28F5NO2S |
| Molecular Weight | 525.58 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | 2-[bis(4-fluorophenyl)methyl]-N-[4-(trifluoromethoxy)phenyl]sulfanyloxan-4-amine;ethane |
| SMILES | CC.Fc1ccc(C(c2ccc(F)cc2)C2CC(NSc3ccc(OC(F)(F)F)cc3)CCO2)cc1 |
| InChI | InChI=1S/C25H22F5NO2S.C2H6/c26-18-5-1-16(2-6-18)24(17-3-7-19(27)8-4-17)23-15-20(13-14-32-23)31-34-22-11-9-21(10-12-22)33-25(28,29)30;1-2/h1-12,20,23-24,31H,13-15H2;1-2H3 |
| InChIKey | AOAPYPWGCKFUHQ-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.58 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|