C23H22O11 — CID 168916438
3,5,6,8-tetrahydroxy-7-[(4R,6S)-6-(hydroxymethyl)-4-methoxyoxan-2-yl]-1-methyl-9,10-dioxoanthracene-2-carboxylic acid (PubChem CID 168916438) has the molecular formula C23H22O11 and a molecular weight of 474.42 g/mol. Its IUPAC name is 3,5,6,8-tetrahydroxy-7-[(4R,6S)-6-(hydroxymethyl)-4-methoxyoxan-2-yl]-1-methyl-9,10-dioxoanthracene-2-carboxylic acid.
| Compound Name | 3,5,6,8-tetrahydroxy-7-[(4R,6S)-6-(hydroxymethyl)-4-methoxyoxan-2-yl]-1-methyl-9,10-dioxoanthracene-2-carboxylic acid |
|---|---|
| PubChem CID | 168916438 |
| Molecular Formula | C23H22O11 |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 3,5,6,8-tetrahydroxy-7-[(4R,6S)-6-(hydroxymethyl)-4-methoxyoxan-2-yl]-1-methyl-9,10-dioxoanthracene-2-carboxylic acid |
| SMILES | CO[C@@H]1CC(c2c(O)c(O)c3c(c2O)C(=O)c2c(cc(O)c(C(=O)O)c2C)C3=O)O[C@H](CO)C1 |
| InChI | InChI=1S/C23H22O11/c1-7-13-10(5-11(25)14(7)23(31)32)18(26)16-17(19(13)27)20(28)15(21(29)22(16)30)12-4-8(33-2)3-9(6-24)34-12/h5,8-9,12,24-25,28-30H,3-4,6H2,1-2H3,(H,31,32)/t8-,9-,12?/m0/s1 |
| InChIKey | FXKMINMMYATFQN-VTGJNACWSA-N |
| XLogP | 1.52 |
| TPSA | 191.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|