C17H28O5Si — CID 168916446
methyl (1R,3S,4R,7S,11S)-3-[tert-butyl(dimethyl)silyl]oxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate (PubChem CID 168916446) has the molecular formula C17H28O5Si and a molecular weight of 340.49 g/mol. Its IUPAC name is methyl (1R,3S,4R,7S,11S)-3-[tert-butyl(dimethyl)silyl]oxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate.
| Compound Name | methyl (1R,3S,4R,7S,11S)-3-[tert-butyl(dimethyl)silyl]oxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate |
|---|---|
| PubChem CID | 168916446 |
| Molecular Formula | C17H28O5Si |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | methyl (1R,3S,4R,7S,11S)-3-[tert-butyl(dimethyl)silyl]oxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H]2O[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3CC[C@H]1[C@H]23 |
| InChI | InChI=1S/C17H28O5Si/c1-17(2,3)23(5,6)22-15-11-8-7-10-12(14(18)19-4)9-20-16(21-15)13(10)11/h9-11,13,15-16H,7-8H2,1-6H3/t10-,11-,13+,15+,16-/m1/s1 |
| InChIKey | CIYRJXKPIRJEAZ-FGKVKJMOSA-N |
| XLogP | 3.42 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|