C11H14O5 — CID 168916506
methyl (1R,3R,4R,7S,11S)-3-hydroxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate (PubChem CID 168916506) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is methyl (1R,3R,4R,7S,11S)-3-hydroxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate.
| Compound Name | methyl (1R,3R,4R,7S,11S)-3-hydroxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate |
|---|---|
| PubChem CID | 168916506 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | methyl (1R,3R,4R,7S,11S)-3-hydroxy-2,10-dioxatricyclo[5.3.1.04,11]undec-8-ene-8-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H]2O[C@@H](O)[C@@H]3CC[C@H]1[C@H]23 |
| InChI | InChI=1S/C11H14O5/c1-14-9(12)7-4-15-11-8-5(7)2-3-6(8)10(13)16-11/h4-6,8,10-11,13H,2-3H2,1H3/t5-,6-,8+,10-,11-/m1/s1 |
| InChIKey | WMKXEXNSAPLOAZ-WSQDPWHSSA-N |
| XLogP | 0.39 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |