About chloromethane;1-[2-(1-ethyl-6-oxopyridazin-3-yl)-1,2,4-triazol-3-yl]ethylazanium
chloromethane;1-[2-(1-ethyl-6-oxopyridazin-3-yl)-1,2,4-triazol-3-yl]ethylazanium (PubChem CID 168917072) has the molecular formula C11H18ClN6O+
and a molecular weight of 285.76 g/mol. Its IUPAC name is chloromethane;1-[2-(1-ethyl-6-oxopyridazin-3-yl)-1,2,4-triazol-3-yl]ethylazanium.
Molecular Properties
| Compound Name | chloromethane;1-[2-(1-ethyl-6-oxopyridazin-3-yl)-1,2,4-triazol-3-yl]ethylazanium |
| PubChem CID | 168917072 |
| Molecular Formula | C11H18ClN6O+ |
| Molecular Weight | 285.76 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | chloromethane;1-[2-(1-ethyl-6-oxopyridazin-3-yl)-1,2,4-triazol-3-yl]ethylazanium |
| SMILES | CCl.CCn1nc(-n2ncnc2C(C)[NH3+])ccc1=O |
| InChI | InChI=1S/C10H14N6O.CH3Cl/c1-3-15-9(17)5-4-8(14-15)16-10(7(2)11)12-6-13-16;1-2/h4-7H,3,11H2,1-2H3;1H3/p+1 |
| InChIKey | RVLFDGNDDNELCG-UHFFFAOYSA-O |
| XLogP | 0.00 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.76 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;1-[2-(1-ethyl-6-oxopyridazin-3-yl)-1,2,4-triazol-3-yl]ethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;1-[2-(1-ethyl-6-oxopyridazin-3-yl)-1,2,4-triazol-3-yl]ethylazanium?
The IUPAC name of chloromethane;1-[2-(1-ethyl-6-oxopyridazin-3-yl)-1,2,4-triazol-3-yl]ethylazanium (CID 168917072) is chloromethane;1-[2-(1-ethyl-6-oxopyridazin-3-yl)-1,2,4-triazol-3-yl]ethylazanium.
What is the SMILES notation for chloromethane;1-[2-(1-ethyl-6-oxopyridazin-3-yl)-1,2,4-triazol-3-yl]ethylazanium?
The canonical SMILES for chloromethane;1-[2-(1-ethyl-6-oxopyridazin-3-yl)-1,2,4-triazol-3-yl]ethylazanium is CCl.CCn1nc(-n2ncnc2C(C)[NH3+])ccc1=O.
What is the InChIKey of chloromethane;1-[2-(1-ethyl-6-oxopyridazin-3-yl)-1,2,4-triazol-3-yl]ethylazanium?
The InChIKey is RVLFDGNDDNELCG-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H14N6O.CH3Cl/c1-3-15-9(17)5-4-8(14-15)16-10(7(2)11)12-6-13-16;1-2/h4-7H,3,11H2,1-2H3;1H3/p+1.
What are the key properties of chloromethane;1-[2-(1-ethyl-6-oxopyridazin-3-yl)-1,2,4-triazol-3-yl]ethylazanium?
chloromethane;1-[2-(1-ethyl-6-oxopyridazin-3-yl)-1,2,4-triazol-3-yl]ethylazanium has a molecular weight of 285.76 g/mol, XLogP of 0.00, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;1-[2-(1-ethyl-6-oxopyridazin-3-yl)-1,2,4-triazol-3-yl]ethylazanium is sourced from PubChem (CID 168917072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).