C19H33N5O3 — CID 168917392
(1R,2S,5S)-3-[(2S,3S)-2-amino-3-methylpentanoyl]-6,6-dimethyl-N'-[[(3S)-2-oxopyrrolidin-3-yl]methyl]-3-azabicyclo[3.1.0]hexane-2-carbohydrazide (PubChem CID 168917392) has the molecular formula C19H33N5O3 and a molecular weight of 379.51 g/mol. Its IUPAC name is (1R,2S,5S)-3-[(2S,3S)-2-amino-3-methylpentanoyl]-6,6-dimethyl-N'-[[(3S)-2-oxopyrrolidin-3-yl]methyl]-3-azabicyclo[3.1.0]hexane-2-carbohydrazide.
| Compound Name | (1R,2S,5S)-3-[(2S,3S)-2-amino-3-methylpentanoyl]-6,6-dimethyl-N'-[[(3S)-2-oxopyrrolidin-3-yl]methyl]-3-azabicyclo[3.1.0]hexane-2-carbohydrazide |
|---|---|
| PubChem CID | 168917392 |
| Molecular Formula | C19H33N5O3 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | (1R,2S,5S)-3-[(2S,3S)-2-amino-3-methylpentanoyl]-6,6-dimethyl-N'-[[(3S)-2-oxopyrrolidin-3-yl]methyl]-3-azabicyclo[3.1.0]hexane-2-carbohydrazide |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)NNC[C@@H]1CCNC1=O)C2(C)C |
| InChI | InChI=1S/C19H33N5O3/c1-5-10(2)14(20)18(27)24-9-12-13(19(12,3)4)15(24)17(26)23-22-8-11-6-7-21-16(11)25/h10-15,22H,5-9,20H2,1-4H3,(H,21,25)(H,23,26)/t10-,11-,12-,13-,14-,15-/m0/s1 |
| InChIKey | YASBNDLPSHLZCR-LZXPERKUSA-N |
| XLogP | -0.40 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|