C22H20Br2N4O6 — CID 168917595
1-(3-bromophenyl)-1,3-diazinane-2,4,6-trione;1-(3-bromophenyl)-6-hydroxypyrimidine-2,4-dione;ethane (PubChem CID 168917595) has the molecular formula C22H20Br2N4O6 and a molecular weight of 596.23 g/mol. Its IUPAC name is 1-(3-bromophenyl)-1,3-diazinane-2,4,6-trione;1-(3-bromophenyl)-6-hydroxypyrimidine-2,4-dione;ethane.
| Compound Name | 1-(3-bromophenyl)-1,3-diazinane-2,4,6-trione;1-(3-bromophenyl)-6-hydroxypyrimidine-2,4-dione;ethane |
|---|---|
| PubChem CID | 168917595 |
| Molecular Formula | C22H20Br2N4O6 |
| Molecular Weight | 596.23 g/mol |
| Exact Mass | 593.97 |
| IUPAC Name | 1-(3-bromophenyl)-1,3-diazinane-2,4,6-trione;1-(3-bromophenyl)-6-hydroxypyrimidine-2,4-dione;ethane |
| SMILES | CC.O=C1CC(=O)N(c2cccc(Br)c2)C(=O)N1.O=c1cc(O)n(-c2cccc(Br)c2)c(=O)[nH]1 |
| InChI | InChI=1S/2C10H7BrN2O3.C2H6/c2*11-6-2-1-3-7(4-6)13-9(15)5-8(14)12-10(13)16;1-2/h1-4H,5H2,(H,12,14,16);1-5,15H,(H,12,14,16);1-2H3 |
| InChIKey | GUVDFQUHKPULES-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 141.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|