About 15H-cyclopenta[a]phenanthren-3-yl 6-methyl-2,6-diazaspiro[3.3]heptane-2-carboxylate
15H-cyclopenta[a]phenanthren-3-yl 6-methyl-2,6-diazaspiro[3.3]heptane-2-carboxylate (PubChem CID 168917795) has the molecular formula C24H22N2O2
and a molecular weight of 370.45 g/mol. Its IUPAC name is 15H-cyclopenta[a]phenanthren-3-yl 6-methyl-2,6-diazaspiro[3.3]heptane-2-carboxylate.
Molecular Properties
| Compound Name | 15H-cyclopenta[a]phenanthren-3-yl 6-methyl-2,6-diazaspiro[3.3]heptane-2-carboxylate |
| PubChem CID | 168917795 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 15H-cyclopenta[a]phenanthren-3-yl 6-methyl-2,6-diazaspiro[3.3]heptane-2-carboxylate |
| SMILES | CN1CC2(C1)CN(C(=O)Oc1ccc3c(ccc4c5c(ccc43)C=CC5)c1)C2 |
| InChI | InChI=1S/C24H22N2O2/c1-25-12-24(13-25)14-26(15-24)23(27)28-18-7-10-20-17(11-18)6-9-21-19-4-2-3-16(19)5-8-22(20)21/h2-3,5-11H,4,12-15H2,1H3 |
| InChIKey | CIVVVMXUKMDJJW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 15H-cyclopenta[a]phenanthren-3-yl 6-methyl-2,6-diazaspiro[3.3]heptane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 15H-cyclopenta[a]phenanthren-3-yl 6-methyl-2,6-diazaspiro[3.3]heptane-2-carboxylate?
The IUPAC name of 15H-cyclopenta[a]phenanthren-3-yl 6-methyl-2,6-diazaspiro[3.3]heptane-2-carboxylate (CID 168917795) is 15H-cyclopenta[a]phenanthren-3-yl 6-methyl-2,6-diazaspiro[3.3]heptane-2-carboxylate.
What is the SMILES notation for 15H-cyclopenta[a]phenanthren-3-yl 6-methyl-2,6-diazaspiro[3.3]heptane-2-carboxylate?
The canonical SMILES for 15H-cyclopenta[a]phenanthren-3-yl 6-methyl-2,6-diazaspiro[3.3]heptane-2-carboxylate is CN1CC2(C1)CN(C(=O)Oc1ccc3c(ccc4c5c(ccc43)C=CC5)c1)C2.
What is the InChIKey of 15H-cyclopenta[a]phenanthren-3-yl 6-methyl-2,6-diazaspiro[3.3]heptane-2-carboxylate?
The InChIKey is CIVVVMXUKMDJJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N2O2/c1-25-12-24(13-25)14-26(15-24)23(27)28-18-7-10-20-17(11-18)6-9-21-19-4-2-3-16(19)5-8-22(20)21/h2-3,5-11H,4,12-15H2,1H3.
What are the key properties of 15H-cyclopenta[a]phenanthren-3-yl 6-methyl-2,6-diazaspiro[3.3]heptane-2-carboxylate?
15H-cyclopenta[a]phenanthren-3-yl 6-methyl-2,6-diazaspiro[3.3]heptane-2-carboxylate has a molecular weight of 370.45 g/mol, XLogP of 4.31, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 15H-cyclopenta[a]phenanthren-3-yl 6-methyl-2,6-diazaspiro[3.3]heptane-2-carboxylate is sourced from PubChem (CID 168917795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).