About (3E,5E)-6-fluoro-3-methyl-1-pyrrolidin-1-ylhepta-3,5-dien-1-one
(3E,5E)-6-fluoro-3-methyl-1-pyrrolidin-1-ylhepta-3,5-dien-1-one (PubChem CID 168918340) has the molecular formula C12H18FNO
and a molecular weight of 211.28 g/mol. Its IUPAC name is (3E,5E)-6-fluoro-3-methyl-1-pyrrolidin-1-ylhepta-3,5-dien-1-one.
Molecular Properties
| Compound Name | (3E,5E)-6-fluoro-3-methyl-1-pyrrolidin-1-ylhepta-3,5-dien-1-one |
| PubChem CID | 168918340 |
| Molecular Formula | C12H18FNO |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (3E,5E)-6-fluoro-3-methyl-1-pyrrolidin-1-ylhepta-3,5-dien-1-one |
| SMILES | C/C(F)=C\C=C(/C)CC(=O)N1CCCC1 |
| InChI | InChI=1S/C12H18FNO/c1-10(5-6-11(2)13)9-12(15)14-7-3-4-8-14/h5-6H,3-4,7-9H2,1-2H3/b10-5+,11-6+ |
| InChIKey | QVBYZVPWVKADEF-YOYBCKCWSA-N |
| XLogP | 2.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5E)-6-fluoro-3-methyl-1-pyrrolidin-1-ylhepta-3,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5E)-6-fluoro-3-methyl-1-pyrrolidin-1-ylhepta-3,5-dien-1-one?
The IUPAC name of (3E,5E)-6-fluoro-3-methyl-1-pyrrolidin-1-ylhepta-3,5-dien-1-one (CID 168918340) is (3E,5E)-6-fluoro-3-methyl-1-pyrrolidin-1-ylhepta-3,5-dien-1-one.
What is the SMILES notation for (3E,5E)-6-fluoro-3-methyl-1-pyrrolidin-1-ylhepta-3,5-dien-1-one?
The canonical SMILES for (3E,5E)-6-fluoro-3-methyl-1-pyrrolidin-1-ylhepta-3,5-dien-1-one is C/C(F)=C\C=C(/C)CC(=O)N1CCCC1.
What is the InChIKey of (3E,5E)-6-fluoro-3-methyl-1-pyrrolidin-1-ylhepta-3,5-dien-1-one?
The InChIKey is QVBYZVPWVKADEF-YOYBCKCWSA-N. The full InChI is InChI=1S/C12H18FNO/c1-10(5-6-11(2)13)9-12(15)14-7-3-4-8-14/h5-6H,3-4,7-9H2,1-2H3/b10-5+,11-6+.
What are the key properties of (3E,5E)-6-fluoro-3-methyl-1-pyrrolidin-1-ylhepta-3,5-dien-1-one?
(3E,5E)-6-fluoro-3-methyl-1-pyrrolidin-1-ylhepta-3,5-dien-1-one has a molecular weight of 211.28 g/mol, XLogP of 2.82, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5E)-6-fluoro-3-methyl-1-pyrrolidin-1-ylhepta-3,5-dien-1-one is sourced from PubChem (CID 168918340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).