About 7-fluoro-1,8-dimethyl-5,6-dihydroisoquinolin-3-amine
7-fluoro-1,8-dimethyl-5,6-dihydroisoquinolin-3-amine (PubChem CID 168918606) has the molecular formula C11H13FN2
and a molecular weight of 192.24 g/mol. Its IUPAC name is 7-fluoro-1,8-dimethyl-5,6-dihydroisoquinolin-3-amine.
Molecular Properties
| Compound Name | 7-fluoro-1,8-dimethyl-5,6-dihydroisoquinolin-3-amine |
| PubChem CID | 168918606 |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 7-fluoro-1,8-dimethyl-5,6-dihydroisoquinolin-3-amine |
| SMILES | CC1=C(F)CCc2cc(N)nc(C)c21 |
| InChI | InChI=1S/C11H13FN2/c1-6-9(12)4-3-8-5-10(13)14-7(2)11(6)8/h5H,3-4H2,1-2H3,(H2,13,14) |
| InChIKey | IVEPBUHZKJTTMU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoro-1,8-dimethyl-5,6-dihydroisoquinolin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-1,8-dimethyl-5,6-dihydroisoquinolin-3-amine?
The IUPAC name of 7-fluoro-1,8-dimethyl-5,6-dihydroisoquinolin-3-amine (CID 168918606) is 7-fluoro-1,8-dimethyl-5,6-dihydroisoquinolin-3-amine.
What is the SMILES notation for 7-fluoro-1,8-dimethyl-5,6-dihydroisoquinolin-3-amine?
The canonical SMILES for 7-fluoro-1,8-dimethyl-5,6-dihydroisoquinolin-3-amine is CC1=C(F)CCc2cc(N)nc(C)c21.
What is the InChIKey of 7-fluoro-1,8-dimethyl-5,6-dihydroisoquinolin-3-amine?
The InChIKey is IVEPBUHZKJTTMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FN2/c1-6-9(12)4-3-8-5-10(13)14-7(2)11(6)8/h5H,3-4H2,1-2H3,(H2,13,14).
What are the key properties of 7-fluoro-1,8-dimethyl-5,6-dihydroisoquinolin-3-amine?
7-fluoro-1,8-dimethyl-5,6-dihydroisoquinolin-3-amine has a molecular weight of 192.24 g/mol, XLogP of 2.62, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-1,8-dimethyl-5,6-dihydroisoquinolin-3-amine is sourced from PubChem (CID 168918606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).