C18H37NO2 — CID 168918832
propyl N,N-diheptylcarbamate (PubChem CID 168918832) has the molecular formula C18H37NO2 and a molecular weight of 299.50 g/mol. Its IUPAC name is propyl N,N-diheptylcarbamate.
| Compound Name | propyl N,N-diheptylcarbamate |
|---|---|
| PubChem CID | 168918832 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | propyl N,N-diheptylcarbamate |
| SMILES | CCCCCCCN(CCCCCCC)C(=O)OCCC |
| InChI | InChI=1S/C18H37NO2/c1-4-7-9-11-13-15-19(18(20)21-17-6-3)16-14-12-10-8-5-2/h4-17H2,1-3H3 |
| InChIKey | ZLHRGUZTWMAIGQ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|