C24H35N3O5 — CID 168919160
tert-butyl N-[(4R)-4-but-3-enyl-1-[(2,4-dimethoxyphenyl)methyl]-4-ethyl-6-oxo-5H-pyrimidin-2-yl]carbamate (PubChem CID 168919160) has the molecular formula C24H35N3O5 and a molecular weight of 445.56 g/mol. Its IUPAC name is tert-butyl N-[(4R)-4-but-3-enyl-1-[(2,4-dimethoxyphenyl)methyl]-4-ethyl-6-oxo-5H-pyrimidin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4R)-4-but-3-enyl-1-[(2,4-dimethoxyphenyl)methyl]-4-ethyl-6-oxo-5H-pyrimidin-2-yl]carbamate |
|---|---|
| PubChem CID | 168919160 |
| Molecular Formula | C24H35N3O5 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | tert-butyl N-[(4R)-4-but-3-enyl-1-[(2,4-dimethoxyphenyl)methyl]-4-ethyl-6-oxo-5H-pyrimidin-2-yl]carbamate |
| SMILES | C=CCC[C@]1(CC)CC(=O)N(Cc2ccc(OC)cc2OC)C(NC(=O)OC(C)(C)C)=N1 |
| InChI | InChI=1S/C24H35N3O5/c1-8-10-13-24(9-2)15-20(28)27(21(26-24)25-22(29)32-23(3,4)5)16-17-11-12-18(30-6)14-19(17)31-7/h8,11-12,14H,1,9-10,13,15-16H2,2-7H3,(H,25,26,29)/t24-/m1/s1 |
| InChIKey | IHFKQIAAUDAGBU-XMMPIXPASA-N |
| XLogP | 4.43 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|