C11H16N2O — CID 168919604
(3Z,5Z)-6-amino-3-(1,2-dihydropyridin-4-yl)hexa-3,5-dien-2-ol (PubChem CID 168919604) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is (3Z,5Z)-6-amino-3-(1,2-dihydropyridin-4-yl)hexa-3,5-dien-2-ol.
| Compound Name | (3Z,5Z)-6-amino-3-(1,2-dihydropyridin-4-yl)hexa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 168919604 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (3Z,5Z)-6-amino-3-(1,2-dihydropyridin-4-yl)hexa-3,5-dien-2-ol |
| SMILES | CC(O)/C(=C\C=C/N)C1=CCNC=C1 |
| InChI | InChI=1S/C11H16N2O/c1-9(14)11(3-2-6-12)10-4-7-13-8-5-10/h2-7,9,13-14H,8,12H2,1H3/b6-2-,11-3+ |
| InChIKey | DIIYYLLOODHNJA-HNDNHIBWSA-N |
| XLogP | 0.81 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|