C11H22N2O2 — CID 168919619
N-[(Z)-2-[ethyl(methyl)amino]but-2-enyl]-2-oxobutanamide;molecular hydrogen (PubChem CID 168919619) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is N-[(Z)-2-[ethyl(methyl)amino]but-2-enyl]-2-oxobutanamide;molecular hydrogen.
| Compound Name | N-[(Z)-2-[ethyl(methyl)amino]but-2-enyl]-2-oxobutanamide;molecular hydrogen |
|---|---|
| PubChem CID | 168919619 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | N-[(Z)-2-[ethyl(methyl)amino]but-2-enyl]-2-oxobutanamide;molecular hydrogen |
| SMILES | C/C=C(/CNC(=O)C(=O)CC)N(C)CC.[H][H] |
| InChI | InChI=1S/C11H20N2O2.H2/c1-5-9(13(4)7-3)8-12-11(15)10(14)6-2;/h5H,6-8H2,1-4H3,(H,12,15);1H/b9-5-; |
| InChIKey | JWYCUYCLAOXROE-UYTGOYFPSA-N |
| XLogP | 1.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|