C25H40BFN2O6 — CID 168920178
tert-butyl N-[(2R)-1-[[(1R)-4-(4-fluorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-methoxy-1-oxopropan-2-yl]carbamate (PubChem CID 168920178) has the molecular formula C25H40BFN2O6 and a molecular weight of 494.41 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[[(1R)-4-(4-fluorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-methoxy-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[[(1R)-4-(4-fluorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-methoxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 168920178 |
| Molecular Formula | C25H40BFN2O6 |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | tert-butyl N-[(2R)-1-[[(1R)-4-(4-fluorophenyl)-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]amino]-3-methoxy-1-oxopropan-2-yl]carbamate |
| SMILES | COC[C@@H](NC(=O)OC(C)(C)C)C(=O)N[C@@H](CCCc1ccc(F)cc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H40BFN2O6/c1-23(2,3)33-22(31)28-19(16-32-8)21(30)29-20(26-34-24(4,5)25(6,7)35-26)11-9-10-17-12-14-18(27)15-13-17/h12-15,19-20H,9-11,16H2,1-8H3,(H,28,31)(H,29,30)/t19-,20+/m1/s1 |
| InChIKey | IJFLTNJMZWELTG-UXHICEINSA-N |
| XLogP | 3.80 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|