About 8-methyl-3,4-dihydro-1,6-naphthyridine
8-methyl-3,4-dihydro-1,6-naphthyridine (PubChem CID 168920411) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 8-methyl-3,4-dihydro-1,6-naphthyridine.
Molecular Properties
| Compound Name | 8-methyl-3,4-dihydro-1,6-naphthyridine |
| PubChem CID | 168920411 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 8-methyl-3,4-dihydro-1,6-naphthyridine |
| SMILES | Cc1cncc2c1N=CCC2 |
| InChI | InChI=1S/C9H10N2/c1-7-5-10-6-8-3-2-4-11-9(7)8/h4-6H,2-3H2,1H3 |
| InChIKey | HUYYWGKZWSRSDW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-methyl-3,4-dihydro-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-3,4-dihydro-1,6-naphthyridine?
The IUPAC name of 8-methyl-3,4-dihydro-1,6-naphthyridine (CID 168920411) is 8-methyl-3,4-dihydro-1,6-naphthyridine.
What is the SMILES notation for 8-methyl-3,4-dihydro-1,6-naphthyridine?
The canonical SMILES for 8-methyl-3,4-dihydro-1,6-naphthyridine is Cc1cncc2c1N=CCC2.
What is the InChIKey of 8-methyl-3,4-dihydro-1,6-naphthyridine?
The InChIKey is HUYYWGKZWSRSDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-7-5-10-6-8-3-2-4-11-9(7)8/h4-6H,2-3H2,1H3.
What are the key properties of 8-methyl-3,4-dihydro-1,6-naphthyridine?
8-methyl-3,4-dihydro-1,6-naphthyridine has a molecular weight of 146.19 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-3,4-dihydro-1,6-naphthyridine is sourced from PubChem (CID 168920411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).