About 7-[1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]-5,6-dihydropyrrolo[1,2-c]imidazol-7-ol
7-[1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]-5,6-dihydropyrrolo[1,2-c]imidazol-7-ol (PubChem CID 168920716) has the molecular formula C17H19F3N4O
and a molecular weight of 352.36 g/mol. Its IUPAC name is 7-[1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]-5,6-dihydropyrrolo[1,2-c]imidazol-7-ol.
Molecular Properties
| Compound Name | 7-[1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]-5,6-dihydropyrrolo[1,2-c]imidazol-7-ol |
| PubChem CID | 168920716 |
| Molecular Formula | C17H19F3N4O |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 7-[1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]-5,6-dihydropyrrolo[1,2-c]imidazol-7-ol |
| SMILES | OC1(C2CCN(c3ccc(C(F)(F)F)nc3)CC2)CCn2cncc21 |
| InChI | InChI=1S/C17H19F3N4O/c18-17(19,20)14-2-1-13(9-22-14)23-6-3-12(4-7-23)16(25)5-8-24-11-21-10-15(16)24/h1-2,9-12,25H,3-8H2 |
| InChIKey | NVCPAZUPAPQQQF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-[1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]-5,6-dihydropyrrolo[1,2-c]imidazol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]-5,6-dihydropyrrolo[1,2-c]imidazol-7-ol?
The IUPAC name of 7-[1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]-5,6-dihydropyrrolo[1,2-c]imidazol-7-ol (CID 168920716) is 7-[1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]-5,6-dihydropyrrolo[1,2-c]imidazol-7-ol.
What is the SMILES notation for 7-[1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]-5,6-dihydropyrrolo[1,2-c]imidazol-7-ol?
The canonical SMILES for 7-[1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]-5,6-dihydropyrrolo[1,2-c]imidazol-7-ol is OC1(C2CCN(c3ccc(C(F)(F)F)nc3)CC2)CCn2cncc21.
What is the InChIKey of 7-[1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]-5,6-dihydropyrrolo[1,2-c]imidazol-7-ol?
The InChIKey is NVCPAZUPAPQQQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F3N4O/c18-17(19,20)14-2-1-13(9-22-14)23-6-3-12(4-7-23)16(25)5-8-24-11-21-10-15(16)24/h1-2,9-12,25H,3-8H2.
What are the key properties of 7-[1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]-5,6-dihydropyrrolo[1,2-c]imidazol-7-ol?
7-[1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]-5,6-dihydropyrrolo[1,2-c]imidazol-7-ol has a molecular weight of 352.36 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[1-[6-(trifluoromethyl)-3-pyridinyl]piperidin-4-yl]-5,6-dihydropyrrolo[1,2-c]imidazol-7-ol is sourced from PubChem (CID 168920716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).